C19H22N5O4S+ — CID 7909495
2-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-1-methyl-5-nitrobenzimidazole (PubChem CID 7909495) has the molecular formula C19H22N5O4S+ and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-1-methyl-5-nitrobenzimidazole.
| Compound Name | 2-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-1-methyl-5-nitrobenzimidazole |
|---|---|
| PubChem CID | 7909495 |
| Molecular Formula | C19H22N5O4S+ |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-1-methyl-5-nitrobenzimidazole |
| SMILES | Cn1c(C[NH+]2CCN(S(=O)(=O)c3ccccc3)CC2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C19H21N5O4S/c1-21-18-8-7-15(24(25)26)13-17(18)20-19(21)14-22-9-11-23(12-10-22)29(27,28)16-5-3-2-4-6-16/h2-8,13H,9-12,14H2,1H3/p+1 |
| InChIKey | QMNCZMCFJUKLNK-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|