C14H20N5O4S+ — CID 7909494
1-methyl-2-[(4-methylsulfonylpiperazin-1-ium-1-yl)methyl]-5-nitrobenzimidazole (PubChem CID 7909494) has the molecular formula C14H20N5O4S+ and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-methyl-2-[(4-methylsulfonylpiperazin-1-ium-1-yl)methyl]-5-nitrobenzimidazole.
| Compound Name | 1-methyl-2-[(4-methylsulfonylpiperazin-1-ium-1-yl)methyl]-5-nitrobenzimidazole |
|---|---|
| PubChem CID | 7909494 |
| Molecular Formula | C14H20N5O4S+ |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-methyl-2-[(4-methylsulfonylpiperazin-1-ium-1-yl)methyl]-5-nitrobenzimidazole |
| SMILES | Cn1c(C[NH+]2CCN(S(C)(=O)=O)CC2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H19N5O4S/c1-16-13-4-3-11(19(20)21)9-12(13)15-14(16)10-17-5-7-18(8-6-17)24(2,22)23/h3-4,9H,5-8,10H2,1-2H3/p+1 |
| InChIKey | MZLUODMFRLHJEC-UHFFFAOYSA-O |
| XLogP | -0.86 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|