C20H26N3O4S+ — CID 8748116
1-[(4-nitrophenyl)methyl]-4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-ium (PubChem CID 8748116) has the molecular formula C20H26N3O4S+ and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methyl]-4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-[(4-nitrophenyl)methyl]-4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 8748116 |
| Molecular Formula | C20H26N3O4S+ |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-[(4-nitrophenyl)methyl]-4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-ium |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CC[NH+](Cc3ccc([N+](=O)[O-])cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H25N3O4S/c1-15-12-16(2)20(17(3)13-15)28(26,27)22-10-8-21(9-11-22)14-18-4-6-19(7-5-18)23(24)25/h4-7,12-13H,8-11,14H2,1-3H3/p+1 |
| InChIKey | RAAKXLQUDQKOAX-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|