C18H20N4O8S — CID 44661394
2-hydroxy-2-oxoacetate;1-(4-nitrophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazin-4-ium (PubChem CID 44661394) has the molecular formula C18H20N4O8S and a molecular weight of 452.45 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;1-(4-nitrophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazin-4-ium.
| Compound Name | 2-hydroxy-2-oxoacetate;1-(4-nitrophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazin-4-ium |
|---|---|
| PubChem CID | 44661394 |
| Molecular Formula | C18H20N4O8S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;1-(4-nitrophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazin-4-ium |
| SMILES | O=C([O-])C(=O)O.O=[N+]([O-])c1ccc(S(=O)(=O)N2CC[NH+](Cc3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C16H18N4O4S.C2H2O4/c21-20(22)15-1-3-16(4-2-15)25(23,24)19-11-9-18(10-12-19)13-14-5-7-17-8-6-14;3-1(4)2(5)6/h1-8H,9-13H2;(H,3,4)(H,5,6) |
| InChIKey | UWMBUCHYNZDUIP-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 175.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|