C12H11F5N2O4S — CID 4215940
2-(benzenesulfonyl)-5-[difluoro(trifluoromethoxy)methyl]-3-methyl-4H-pyrazol-3-ol (PubChem CID 4215940) has the molecular formula C12H11F5N2O4S and a molecular weight of 374.29 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-5-[difluoro(trifluoromethoxy)methyl]-3-methyl-4H-pyrazol-3-ol.
| Compound Name | 2-(benzenesulfonyl)-5-[difluoro(trifluoromethoxy)methyl]-3-methyl-4H-pyrazol-3-ol |
|---|---|
| PubChem CID | 4215940 |
| Molecular Formula | C12H11F5N2O4S |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-(benzenesulfonyl)-5-[difluoro(trifluoromethoxy)methyl]-3-methyl-4H-pyrazol-3-ol |
| SMILES | CC1(O)CC(C(F)(F)OC(F)(F)F)=NN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H11F5N2O4S/c1-10(20)7-9(11(13,14)23-12(15,16)17)18-19(10)24(21,22)8-5-3-2-4-6-8/h2-6,20H,7H2,1H3 |
| InChIKey | YRIAXWPQQAOECK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |