C18H26N4 — CID 42194213
(3R)-N-(4-propan-2-ylphenyl)-1-(1H-pyrazol-5-ylmethyl)piperidin-3-amine (PubChem CID 42194213) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is (3R)-N-(4-propan-2-ylphenyl)-1-(1H-pyrazol-5-ylmethyl)piperidin-3-amine.
| Compound Name | (3R)-N-(4-propan-2-ylphenyl)-1-(1H-pyrazol-5-ylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 42194213 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | (3R)-N-(4-propan-2-ylphenyl)-1-(1H-pyrazol-5-ylmethyl)piperidin-3-amine |
| SMILES | CC(C)c1ccc(N[C@@H]2CCCN(Cc3ccn[nH]3)C2)cc1 |
| InChI | InChI=1S/C18H26N4/c1-14(2)15-5-7-16(8-6-15)20-17-4-3-11-22(12-17)13-18-9-10-19-21-18/h5-10,14,17,20H,3-4,11-13H2,1-2H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | OSBXDGRXCIEXQA-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |