C23H29N5 — CID 45242588
N-(4-propan-2-ylphenyl)-1-[(1-pyrimidin-2-ylpyrrol-2-yl)methyl]piperidin-3-amine (PubChem CID 45242588) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-1-[(1-pyrimidin-2-ylpyrrol-2-yl)methyl]piperidin-3-amine.
| Compound Name | N-(4-propan-2-ylphenyl)-1-[(1-pyrimidin-2-ylpyrrol-2-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 45242588 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-1-[(1-pyrimidin-2-ylpyrrol-2-yl)methyl]piperidin-3-amine |
| SMILES | CC(C)c1ccc(NC2CCCN(Cc3cccn3-c3ncccn3)C2)cc1 |
| InChI | InChI=1S/C23H29N5/c1-18(2)19-8-10-20(11-9-19)26-21-6-3-14-27(16-21)17-22-7-4-15-28(22)23-24-12-5-13-25-23/h4-5,7-13,15,18,21,26H,3,6,14,16-17H2,1-2H3 |
| InChIKey | WTVJCYMOOSLBFC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |