C19H30N2S — CID 56718877
N-(4-propan-2-ylphenyl)-1-(thian-4-yl)piperidin-3-amine (PubChem CID 56718877) has the molecular formula C19H30N2S and a molecular weight of 318.53 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-1-(thian-4-yl)piperidin-3-amine.
| Compound Name | N-(4-propan-2-ylphenyl)-1-(thian-4-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 56718877 |
| Molecular Formula | C19H30N2S |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-1-(thian-4-yl)piperidin-3-amine |
| SMILES | CC(C)c1ccc(NC2CCCN(C3CCSCC3)C2)cc1 |
| InChI | InChI=1S/C19H30N2S/c1-15(2)16-5-7-17(8-6-16)20-18-4-3-11-21(14-18)19-9-12-22-13-10-19/h5-8,15,18-20H,3-4,9-14H2,1-2H3 |
| InChIKey | IFNJEMLTBUVTTI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |