C18H26F2N2O2S — CID 133296240
1-cyclohexyl-N-[4-(difluoromethylsulfonyl)phenyl]piperidin-3-amine (PubChem CID 133296240) has the molecular formula C18H26F2N2O2S and a molecular weight of 372.48 g/mol. Its IUPAC name is 1-cyclohexyl-N-[4-(difluoromethylsulfonyl)phenyl]piperidin-3-amine.
| Compound Name | 1-cyclohexyl-N-[4-(difluoromethylsulfonyl)phenyl]piperidin-3-amine |
|---|---|
| PubChem CID | 133296240 |
| Molecular Formula | C18H26F2N2O2S |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-cyclohexyl-N-[4-(difluoromethylsulfonyl)phenyl]piperidin-3-amine |
| SMILES | O=S(=O)(c1ccc(NC2CCCN(C3CCCCC3)C2)cc1)C(F)F |
| InChI | InChI=1S/C18H26F2N2O2S/c19-18(20)25(23,24)17-10-8-14(9-11-17)21-15-5-4-12-22(13-15)16-6-2-1-3-7-16/h8-11,15-16,18,21H,1-7,12-13H2 |
| InChIKey | VOTFMBHGLNWURK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |