C16H23FN2S2 — CID 26315908
(3R)-1-(1,4-dithiepan-6-yl)-N-(4-fluorophenyl)piperidin-3-amine (PubChem CID 26315908) has the molecular formula C16H23FN2S2 and a molecular weight of 326.51 g/mol. Its IUPAC name is (3R)-1-(1,4-dithiepan-6-yl)-N-(4-fluorophenyl)piperidin-3-amine.
| Compound Name | (3R)-1-(1,4-dithiepan-6-yl)-N-(4-fluorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 26315908 |
| Molecular Formula | C16H23FN2S2 |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (3R)-1-(1,4-dithiepan-6-yl)-N-(4-fluorophenyl)piperidin-3-amine |
| SMILES | Fc1ccc(N[C@@H]2CCCN(C3CSCCSC3)C2)cc1 |
| InChI | InChI=1S/C16H23FN2S2/c17-13-3-5-14(6-4-13)18-15-2-1-7-19(10-15)16-11-20-8-9-21-12-16/h3-6,15-16,18H,1-2,7-12H2/t15-/m1/s1 |
| InChIKey | QGODVYMFFLLCAZ-OAHLLOKOSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |