C29H33N3O2 — CID 4222006
N-(2,2-diphenylethylideneamino)-4-(octanoylamino)benzamide (PubChem CID 4222006) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-(2,2-diphenylethylideneamino)-4-(octanoylamino)benzamide.
| Compound Name | N-(2,2-diphenylethylideneamino)-4-(octanoylamino)benzamide |
|---|---|
| PubChem CID | 4222006 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-(2,2-diphenylethylideneamino)-4-(octanoylamino)benzamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(C(=O)NN=CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H33N3O2/c1-2-3-4-5-12-17-28(33)31-26-20-18-25(19-21-26)29(34)32-30-22-27(23-13-8-6-9-14-23)24-15-10-7-11-16-24/h6-11,13-16,18-22,27H,2-5,12,17H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | LDHPKCNUTXVECP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|