C10H8N5O3S- — CID 4226066
3-[5-(2-amino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoate (PubChem CID 4226066) has the molecular formula C10H8N5O3S- and a molecular weight of 278.27 g/mol. Its IUPAC name is 3-[5-(2-amino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoate.
| Compound Name | 3-[5-(2-amino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 4226066 |
| Molecular Formula | C10H8N5O3S- |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 3-[5-(2-amino-2-oxoethyl)sulfanyltetrazol-1-yl]benzoate |
| SMILES | NC(=O)CSc1nnnn1-c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C10H9N5O3S/c11-8(16)5-19-10-12-13-14-15(10)7-3-1-2-6(4-7)9(17)18/h1-4H,5H2,(H2,11,16)(H,17,18)/p-1 |
| InChIKey | WUJHBPKAHRXETD-UHFFFAOYSA-M |
| XLogP | -1.40 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |