C20H18BrF3N2O — CID 4227514
1-(4-bromophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 4227514) has the molecular formula C20H18BrF3N2O and a molecular weight of 439.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4227514 |
| Molecular Formula | C20H18BrF3N2O |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 1-(4-bromophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=CN1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H18BrF3N2O/c21-17-6-4-15(5-7-17)19(27)8-9-25-10-12-26(13-11-25)18-3-1-2-16(14-18)20(22,23)24/h1-9,14H,10-13H2 |
| InChIKey | CIHFUCYTJBHFBA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|