C16H11Cl2N4O3S+ — CID 4227556
2-amino-N-(2,5-dichlorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-3-ium-5-carboxamide (PubChem CID 4227556) has the molecular formula C16H11Cl2N4O3S+ and a molecular weight of 410.26 g/mol. Its IUPAC name is 2-amino-N-(2,5-dichlorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-3-ium-5-carboxamide.
| Compound Name | 2-amino-N-(2,5-dichlorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-3-ium-5-carboxamide |
|---|---|
| PubChem CID | 4227556 |
| Molecular Formula | C16H11Cl2N4O3S+ |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 2-amino-N-(2,5-dichlorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-3-ium-5-carboxamide |
| SMILES | Nc1[nH+]c(-c2ccc([N+](=O)[O-])cc2)c(C(=O)Nc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C16H10Cl2N4O3S/c17-9-3-6-11(18)12(7-9)20-15(23)14-13(21-16(19)26-14)8-1-4-10(5-2-8)22(24)25/h1-7H,(H2,19,21)(H,20,23)/p+1 |
| InChIKey | HEILCTQMJMMPJY-UHFFFAOYSA-O |
| XLogP | 4.28 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|