C24H26FNO3 — CID 42275729
(E)-N-cyclopropyl-3-(3-fluorophenyl)-N-[[4-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]prop-2-enamide (PubChem CID 42275729) has the molecular formula C24H26FNO3 and a molecular weight of 395.47 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-(3-fluorophenyl)-N-[[4-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-(3-fluorophenyl)-N-[[4-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 42275729 |
| Molecular Formula | C24H26FNO3 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (E)-N-cyclopropyl-3-(3-fluorophenyl)-N-[[4-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]prop-2-enamide |
| SMILES | CC1(COc2ccc(CN(C(=O)/C=C/c3cccc(F)c3)C3CC3)cc2)COC1 |
| InChI | InChI=1S/C24H26FNO3/c1-24(15-28-16-24)17-29-22-10-5-19(6-11-22)14-26(21-8-9-21)23(27)12-7-18-3-2-4-20(25)13-18/h2-7,10-13,21H,8-9,14-17H2,1H3/b12-7+ |
| InChIKey | DLGHFNRVJIYVKD-KPKJPENVSA-N |
| XLogP | 4.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|