C26H27FN2O2 — CID 26276742
(E)-3-(3-fluorophenyl)-N-[[4-(2-methylpropoxy)phenyl]methyl]-N-(pyridin-4-ylmethyl)prop-2-enamide (PubChem CID 26276742) has the molecular formula C26H27FN2O2 and a molecular weight of 418.51 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-[[4-(2-methylpropoxy)phenyl]methyl]-N-(pyridin-4-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-[[4-(2-methylpropoxy)phenyl]methyl]-N-(pyridin-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 26276742 |
| Molecular Formula | C26H27FN2O2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-[[4-(2-methylpropoxy)phenyl]methyl]-N-(pyridin-4-ylmethyl)prop-2-enamide |
| SMILES | CC(C)COc1ccc(CN(Cc2ccncc2)C(=O)/C=C/c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C26H27FN2O2/c1-20(2)19-31-25-9-6-22(7-10-25)17-29(18-23-12-14-28-15-13-23)26(30)11-8-21-4-3-5-24(27)16-21/h3-16,20H,17-19H2,1-2H3/b11-8+ |
| InChIKey | HEAXAOBDGMKXJU-DHZHZOJOSA-N |
| XLogP | 5.50 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|