C25H22ClFN2O2 — CID 74501509
N-[[4-(2-chloroprop-2-enoxy)phenyl]methyl]-3-(3-fluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 74501509) has the molecular formula C25H22ClFN2O2 and a molecular weight of 436.91 g/mol. Its IUPAC name is N-[[4-(2-chloroprop-2-enoxy)phenyl]methyl]-3-(3-fluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | N-[[4-(2-chloroprop-2-enoxy)phenyl]methyl]-3-(3-fluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 74501509 |
| Molecular Formula | C25H22ClFN2O2 |
| Molecular Weight | 436.91 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[[4-(2-chloroprop-2-enoxy)phenyl]methyl]-3-(3-fluorophenyl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | C=C(Cl)COc1ccc(CN(Cc2ccccn2)C(=O)C=Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C25H22ClFN2O2/c1-19(26)18-31-24-11-8-21(9-12-24)16-29(17-23-7-2-3-14-28-23)25(30)13-10-20-5-4-6-22(27)15-20/h2-15H,1,16-18H2 |
| InChIKey | NLBMFAFSLZCRQO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.91 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|