C16H20ClN3O2S — CID 42282708
N-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-methylpyrazole-4-sulfonamide (PubChem CID 42282708) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-methylpyrazole-4-sulfonamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42282708 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-methylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C2CCCC2)cc1S(=O)(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3O2S/c1-12-16(11-20(19-12)15-4-2-3-5-15)23(21,22)18-10-13-6-8-14(17)9-7-13/h6-9,11,15,18H,2-5,10H2,1H3 |
| InChIKey | GSQYSIOHVGCYHE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |