C24H35N3O2 — CID 42286901
ethyl 1-[(5-methyl-1-propylpyrazol-4-yl)methyl]-4-(2-phenylethyl)piperidine-4-carboxylate (PubChem CID 42286901) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is ethyl 1-[(5-methyl-1-propylpyrazol-4-yl)methyl]-4-(2-phenylethyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(5-methyl-1-propylpyrazol-4-yl)methyl]-4-(2-phenylethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42286901 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | ethyl 1-[(5-methyl-1-propylpyrazol-4-yl)methyl]-4-(2-phenylethyl)piperidine-4-carboxylate |
| SMILES | CCCn1ncc(CN2CCC(CCc3ccccc3)(C(=O)OCC)CC2)c1C |
| InChI | InChI=1S/C24H35N3O2/c1-4-15-27-20(3)22(18-25-27)19-26-16-13-24(14-17-26,23(28)29-5-2)12-11-21-9-7-6-8-10-21/h6-10,18H,4-5,11-17,19H2,1-3H3 |
| InChIKey | ORBKQZLXZWLGPO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |