C28H25N3O3 — CID 42288019
2-methyl-4-[(3S)-3-(4-phenylbenzoyl)piperidine-1-carbonyl]phthalazin-1-one (PubChem CID 42288019) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-methyl-4-[(3S)-3-(4-phenylbenzoyl)piperidine-1-carbonyl]phthalazin-1-one.
| Compound Name | 2-methyl-4-[(3S)-3-(4-phenylbenzoyl)piperidine-1-carbonyl]phthalazin-1-one |
|---|---|
| PubChem CID | 42288019 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-methyl-4-[(3S)-3-(4-phenylbenzoyl)piperidine-1-carbonyl]phthalazin-1-one |
| SMILES | Cn1nc(C(=O)N2CCC[C@H](C(=O)c3ccc(-c4ccccc4)cc3)C2)c2ccccc2c1=O |
| InChI | InChI=1S/C28H25N3O3/c1-30-27(33)24-12-6-5-11-23(24)25(29-30)28(34)31-17-7-10-22(18-31)26(32)21-15-13-20(14-16-21)19-8-3-2-4-9-19/h2-6,8-9,11-16,22H,7,10,17-18H2,1H3/t22-/m0/s1 |
| InChIKey | RDUQKYXGASMJLH-QFIPXVFZSA-N |
| XLogP | 4.34 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |