C18H33N3O3 — CID 42304222
(3R)-3-[2-[4-(methoxymethyl)piperidin-1-yl]-2-oxoethyl]-4-(3-methylbutyl)piperazin-2-one (PubChem CID 42304222) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is (3R)-3-[2-[4-(methoxymethyl)piperidin-1-yl]-2-oxoethyl]-4-(3-methylbutyl)piperazin-2-one.
| Compound Name | (3R)-3-[2-[4-(methoxymethyl)piperidin-1-yl]-2-oxoethyl]-4-(3-methylbutyl)piperazin-2-one |
|---|---|
| PubChem CID | 42304222 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | (3R)-3-[2-[4-(methoxymethyl)piperidin-1-yl]-2-oxoethyl]-4-(3-methylbutyl)piperazin-2-one |
| SMILES | COCC1CCN(C(=O)C[C@@H]2C(=O)NCCN2CCC(C)C)CC1 |
| InChI | InChI=1S/C18H33N3O3/c1-14(2)4-8-20-11-7-19-18(23)16(20)12-17(22)21-9-5-15(6-10-21)13-24-3/h14-16H,4-13H2,1-3H3,(H,19,23)/t16-/m1/s1 |
| InChIKey | CUSPSSJHCHHSDY-MRXNPFEDSA-N |
| XLogP | 1.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |