C16H29N3O4 — CID 25454660
methyl 4-[[2-[(2R)-1-(3-methylbutyl)-3-oxopiperazin-2-yl]acetyl]amino]butanoate (PubChem CID 25454660) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is methyl 4-[[2-[(2R)-1-(3-methylbutyl)-3-oxopiperazin-2-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(2R)-1-(3-methylbutyl)-3-oxopiperazin-2-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 25454660 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | methyl 4-[[2-[(2R)-1-(3-methylbutyl)-3-oxopiperazin-2-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)C[C@@H]1C(=O)NCCN1CCC(C)C |
| InChI | InChI=1S/C16H29N3O4/c1-12(2)6-9-19-10-8-18-16(22)13(19)11-14(20)17-7-4-5-15(21)23-3/h12-13H,4-11H2,1-3H3,(H,17,20)(H,18,22)/t13-/m1/s1 |
| InChIKey | ISYUDORGTVOKNP-CYBMUJFWSA-N |
| XLogP | 0.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|