C18H33N3O4 — CID 54819590
propyl 2-[1-[2-(heptylamino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54819590) has the molecular formula C18H33N3O4 and a molecular weight of 355.48 g/mol. Its IUPAC name is propyl 2-[1-[2-(heptylamino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[1-[2-(heptylamino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54819590 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | propyl 2-[1-[2-(heptylamino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCNC(=O)CN1CCNC(=O)C1CC(=O)OCCC |
| InChI | InChI=1S/C18H33N3O4/c1-3-5-6-7-8-9-19-16(22)14-21-11-10-20-18(24)15(21)13-17(23)25-12-4-2/h15H,3-14H2,1-2H3,(H,19,22)(H,20,24) |
| InChIKey | ICYZTOPUQNZSNK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|