C20H29N3O4 — CID 54820041
propyl 2-[1-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54820041) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is propyl 2-[1-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[1-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54820041 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | propyl 2-[1-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)CC1C(=O)NCCN1CC(=O)Nc1c(C)cccc1CC |
| InChI | InChI=1S/C20H29N3O4/c1-4-11-27-18(25)12-16-20(26)21-9-10-23(16)13-17(24)22-19-14(3)7-6-8-15(19)5-2/h6-8,16H,4-5,9-13H2,1-3H3,(H,21,26)(H,22,24) |
| InChIKey | XAZQDRAYDAOANZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |