C17H29N3O4 — CID 54819623
propyl 2-[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54819623) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is propyl 2-[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54819623 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | propyl 2-[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)CC1C(=O)NCCN1CC(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C17H29N3O4/c1-3-10-24-16(22)11-14-17(23)18-6-9-20(14)12-15(21)19-7-4-13(2)5-8-19/h13-14H,3-12H2,1-2H3,(H,18,23) |
| InChIKey | GNLYSFATWIBURM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |