C19H22FN3O2 — CID 42309035
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]acetamide (PubChem CID 42309035) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]acetamide |
|---|---|
| PubChem CID | 42309035 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]acetamide |
| SMILES | CCc1[nH]c2c(CNC(=O)Cc3c(C)noc3C)cc(F)cc2c1C |
| InChI | InChI=1S/C19H22FN3O2/c1-5-17-10(2)15-7-14(20)6-13(19(15)22-17)9-21-18(24)8-16-11(3)23-25-12(16)4/h6-7,22H,5,8-9H2,1-4H3,(H,21,24) |
| InChIKey | ZQCDQZGDWVKNTO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|