C29H35N2O3+ — CID 4233373
N-benzyl-1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]pyridin-1-ium-4-carboxamide (PubChem CID 4233373) has the molecular formula C29H35N2O3+ and a molecular weight of 459.61 g/mol. Its IUPAC name is N-benzyl-1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]pyridin-1-ium-4-carboxamide.
| Compound Name | N-benzyl-1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 4233373 |
| Molecular Formula | C29H35N2O3+ |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | N-benzyl-1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]pyridin-1-ium-4-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)C[n+]2ccc(C(=O)NCc3ccccc3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C29H34N2O3/c1-28(2,3)23-16-22(17-24(26(23)33)29(4,5)6)25(32)19-31-14-12-21(13-15-31)27(34)30-18-20-10-8-7-9-11-20/h7-17H,18-19H2,1-6H3,(H-,30,32,33,34)/p+1 |
| InChIKey | MWKZGMVVFFQEMN-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 70.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|