C21H29BrN2O2 — CID 23724198
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-ethenylimidazol-1-ium-1-yl)ethanone bromide (PubChem CID 23724198) has the molecular formula C21H29BrN2O2 and a molecular weight of 421.38 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-ethenylimidazol-1-ium-1-yl)ethanone bromide.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-ethenylimidazol-1-ium-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 23724198 |
| Molecular Formula | C21H29BrN2O2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(3-ethenylimidazol-1-ium-1-yl)ethanone bromide |
| SMILES | C=Cn1cc[n+](CC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1.[Br-] |
| InChI | InChI=1S/C21H28N2O2.BrH/c1-8-22-9-10-23(14-22)13-18(24)15-11-16(20(2,3)4)19(25)17(12-15)21(5,6)7;/h8-12,14H,1,13H2,2-7H3;1H |
| InChIKey | ZGZHLVBBXNIGMS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|