C20H28NO2S+ — CID 18432205
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(4-methyl-1,3-thiazol-3-ium-3-yl)ethanone (PubChem CID 18432205) has the molecular formula C20H28NO2S+ and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(4-methyl-1,3-thiazol-3-ium-3-yl)ethanone.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(4-methyl-1,3-thiazol-3-ium-3-yl)ethanone |
|---|---|
| PubChem CID | 18432205 |
| Molecular Formula | C20H28NO2S+ |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(4-methyl-1,3-thiazol-3-ium-3-yl)ethanone |
| SMILES | Cc1csc[n+]1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H27NO2S/c1-13-11-24-12-21(13)10-17(22)14-8-15(19(2,3)4)18(23)16(9-14)20(5,6)7/h8-9,11-12H,10H2,1-7H3/p+1 |
| InChIKey | YAQVRYWYSYZPIP-UHFFFAOYSA-O |
| XLogP | 4.53 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|