C6H11NO4S — CID 90480238
2-(4-methyl-1,3-thiazol-3-ium-3-yl)acetate;dihydrate (PubChem CID 90480238) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-3-ium-3-yl)acetate;dihydrate.
| Compound Name | 2-(4-methyl-1,3-thiazol-3-ium-3-yl)acetate;dihydrate |
|---|---|
| PubChem CID | 90480238 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-3-ium-3-yl)acetate;dihydrate |
| SMILES | Cc1csc[n+]1CC(=O)[O-].O.O |
| InChI | InChI=1S/C6H7NO2S.2H2O/c1-5-3-10-4-7(5)2-6(8)9;;/h3-4H,2H2,1H3;2*1H2 |
| InChIKey | WTZAUSXNSUSFHX-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 107.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|