C22H27N3O3S — CID 42344985
3-tert-butyl-N-[2-(3-methoxyphenyl)ethyl]-1-phenylpyrazole-4-sulfonamide (PubChem CID 42344985) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-tert-butyl-N-[2-(3-methoxyphenyl)ethyl]-1-phenylpyrazole-4-sulfonamide.
| Compound Name | 3-tert-butyl-N-[2-(3-methoxyphenyl)ethyl]-1-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42344985 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 3-tert-butyl-N-[2-(3-methoxyphenyl)ethyl]-1-phenylpyrazole-4-sulfonamide |
| SMILES | COc1cccc(CCNS(=O)(=O)c2cn(-c3ccccc3)nc2C(C)(C)C)c1 |
| InChI | InChI=1S/C22H27N3O3S/c1-22(2,3)21-20(16-25(24-21)18-10-6-5-7-11-18)29(26,27)23-14-13-17-9-8-12-19(15-17)28-4/h5-12,15-16,23H,13-14H2,1-4H3 |
| InChIKey | FIQDFPVZEHDSIF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |