C24H30N2O3 — CID 42375914
(4aR,8aS)-6-[(E)-3-(furan-2-yl)prop-2-enyl]-1-[2-(3-methoxyphenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 42375914) has the molecular formula C24H30N2O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is (4aR,8aS)-6-[(E)-3-(furan-2-yl)prop-2-enyl]-1-[2-(3-methoxyphenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-[(E)-3-(furan-2-yl)prop-2-enyl]-1-[2-(3-methoxyphenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 42375914 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (4aR,8aS)-6-[(E)-3-(furan-2-yl)prop-2-enyl]-1-[2-(3-methoxyphenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COc1cccc(CCN2C(=O)CC[C@@H]3CN(C/C=C/c4ccco4)CC[C@@H]32)c1 |
| InChI | InChI=1S/C24H30N2O3/c1-28-22-6-2-5-19(17-22)11-15-26-23-12-14-25(18-20(23)9-10-24(26)27)13-3-7-21-8-4-16-29-21/h2-8,16-17,20,23H,9-15,18H2,1H3/b7-3+/t20-,23+/m1/s1 |
| InChIKey | MUTYOCNFEUAOSG-MXJNXPACSA-N |
| XLogP | 3.86 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |