C26H38N2O2 — CID 91940233
(4aR,8aS)-1-(2-cyclohexylethyl)-6-[3-(4-methoxyphenyl)prop-2-enyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 91940233) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is (4aR,8aS)-1-(2-cyclohexylethyl)-6-[3-(4-methoxyphenyl)prop-2-enyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-(2-cyclohexylethyl)-6-[3-(4-methoxyphenyl)prop-2-enyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 91940233 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | (4aR,8aS)-1-(2-cyclohexylethyl)-6-[3-(4-methoxyphenyl)prop-2-enyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COc1ccc(C=CCN2CC[C@H]3[C@H](CCC(=O)N3CCC3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C26H38N2O2/c1-30-24-12-9-22(10-13-24)8-5-17-27-18-16-25-23(20-27)11-14-26(29)28(25)19-15-21-6-3-2-4-7-21/h5,8-10,12-13,21,23,25H,2-4,6-7,11,14-20H2,1H3/t23-,25+/m1/s1 |
| InChIKey | DINLKPJUOBJDNO-NOZRDPDXSA-N |
| XLogP | 4.99 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |