C20H32ClN3O2 — CID 42382097
3-[(3S,4R)-1-[(3-chlorophenyl)methyl]-4-(dimethylamino)piperidin-3-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 42382097) has the molecular formula C20H32ClN3O2 and a molecular weight of 381.95 g/mol. Its IUPAC name is 3-[(3S,4R)-1-[(3-chlorophenyl)methyl]-4-(dimethylamino)piperidin-3-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[(3S,4R)-1-[(3-chlorophenyl)methyl]-4-(dimethylamino)piperidin-3-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 42382097 |
| Molecular Formula | C20H32ClN3O2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 3-[(3S,4R)-1-[(3-chlorophenyl)methyl]-4-(dimethylamino)piperidin-3-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CC[C@H]1CN(Cc2cccc(Cl)c2)CC[C@H]1N(C)C |
| InChI | InChI=1S/C20H32ClN3O2/c1-23(2)19-9-11-24(14-16-5-4-6-18(21)13-16)15-17(19)7-8-20(25)22-10-12-26-3/h4-6,13,17,19H,7-12,14-15H2,1-3H3,(H,22,25)/t17-,19+/m0/s1 |
| InChIKey | JFNLUFZZNGEVRH-PKOBYXMFSA-N |
| XLogP | 2.63 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|