C16H15N7OS — CID 42415438
6-N-benzyl-5-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 42415438) has the molecular formula C16H15N7OS and a molecular weight of 353.41 g/mol. Its IUPAC name is 6-N-benzyl-5-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 6-N-benzyl-5-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 42415438 |
| Molecular Formula | C16H15N7OS |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 6-N-benzyl-5-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | Cc1nc(CNc2nc3nonc3nc2NCc2ccccc2)cs1 |
| InChI | InChI=1S/C16H15N7OS/c1-10-19-12(9-25-10)8-18-14-13(17-7-11-5-3-2-4-6-11)20-15-16(21-14)23-24-22-15/h2-6,9H,7-8H2,1H3,(H,17,20,22)(H,18,21,23) |
| InChIKey | KZTNIBMKOGNNFO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |