C31H37N3O5 — CID 4245125
N-(1-hydroxy-3-phenylpropan-2-yl)-2-[3-(1H-indol-3-ylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]acetamide (PubChem CID 4245125) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)-2-[3-(1H-indol-3-ylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]acetamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)-2-[3-(1H-indol-3-ylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]acetamide |
|---|---|
| PubChem CID | 4245125 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)-2-[3-(1H-indol-3-ylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]acetamide |
| SMILES | O=C(CC1CC=CCCCC(=O)OCC(Cc2c[nH]c3ccccc23)NC1=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C31H37N3O5/c35-20-25(16-22-10-4-3-5-11-22)33-29(36)18-23-12-6-1-2-7-15-30(37)39-21-26(34-31(23)38)17-24-19-32-28-14-9-8-13-27(24)28/h1,3-6,8-11,13-14,19,23,25-26,32,35H,2,7,12,15-18,20-21H2,(H,33,36)(H,34,38) |
| InChIKey | AKJILCJHATVIOK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|