C28H37N3O5 — CID 6608732
N-[1-(hydroxymethyl)cyclopentyl]-2-[(3S,6R)-3-(1H-indol-3-ylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]acetamide (PubChem CID 6608732) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclopentyl]-2-[(3S,6R)-3-(1H-indol-3-ylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]acetamide.
| Compound Name | N-[1-(hydroxymethyl)cyclopentyl]-2-[(3S,6R)-3-(1H-indol-3-ylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]acetamide |
|---|---|
| PubChem CID | 6608732 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclopentyl]-2-[(3S,6R)-3-(1H-indol-3-ylmethyl)-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]acetamide |
| SMILES | O=C(C[C@H]1CC=CCCCC(=O)OC[C@H](Cc2c[nH]c3ccccc23)NC1=O)NC1(CO)CCCC1 |
| InChI | InChI=1S/C28H37N3O5/c32-19-28(13-7-8-14-28)31-25(33)16-20-9-3-1-2-4-12-26(34)36-18-22(30-27(20)35)15-21-17-29-24-11-6-5-10-23(21)24/h1,3,5-6,10-11,17,20,22,29,32H,2,4,7-9,12-16,18-19H2,(H,30,35)(H,31,33)/t20-,22+/m1/s1 |
| InChIKey | FEUYNAXYACWOIJ-IRLDBZIGSA-N |
| XLogP | 3.30 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|