C23H38N2O5 — CID 4523732
2-(3-tert-butyl-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl)-N-[1-(hydroxymethyl)cyclopentyl]acetamide (PubChem CID 4523732) has the molecular formula C23H38N2O5 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-(3-tert-butyl-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl)-N-[1-(hydroxymethyl)cyclopentyl]acetamide.
| Compound Name | 2-(3-tert-butyl-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl)-N-[1-(hydroxymethyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 4523732 |
| Molecular Formula | C23H38N2O5 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 2-(3-tert-butyl-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl)-N-[1-(hydroxymethyl)cyclopentyl]acetamide |
| SMILES | CC(C)(C)C1COC(=O)CCCC=CCC(CC(=O)NC2(CO)CCCC2)C(=O)N1 |
| InChI | InChI=1S/C23H38N2O5/c1-22(2,3)18-15-30-20(28)11-7-5-4-6-10-17(21(29)24-18)14-19(27)25-23(16-26)12-8-9-13-23/h4,6,17-18,26H,5,7-16H2,1-3H3,(H,24,29)(H,25,27) |
| InChIKey | DGPNQFXATZWPMA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|