C24H31N3O5 — CID 4622985
N-(1-hydroxypropan-2-yl)-2-[3-(1H-indol-3-ylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetamide (PubChem CID 4622985) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-2-[3-(1H-indol-3-ylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-2-[3-(1H-indol-3-ylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetamide |
|---|---|
| PubChem CID | 4622985 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-2-[3-(1H-indol-3-ylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetamide |
| SMILES | CC(CO)NC(=O)CC1CC=CCCC(=O)OCC(Cc2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C24H31N3O5/c1-16(14-28)26-22(29)12-17-7-3-2-4-10-23(30)32-15-19(27-24(17)31)11-18-13-25-21-9-6-5-8-20(18)21/h2-3,5-6,8-9,13,16-17,19,25,28H,4,7,10-12,14-15H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | QHWUOHDNWGRDGO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|