C19H24N4 — CID 42461383
(1S)-1-tert-butyl-2-(1H-pyrazol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 42461383) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is (1S)-1-tert-butyl-2-(1H-pyrazol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-1-tert-butyl-2-(1H-pyrazol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 42461383 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (1S)-1-tert-butyl-2-(1H-pyrazol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC(C)(C)[C@H]1c2[nH]c3ccccc3c2CCN1Cc1ccn[nH]1 |
| InChI | InChI=1S/C19H24N4/c1-19(2,3)18-17-15(14-6-4-5-7-16(14)21-17)9-11-23(18)12-13-8-10-20-22-13/h4-8,10,18,21H,9,11-12H2,1-3H3,(H,20,22)/t18-/m1/s1 |
| InChIKey | MSJCBMHSNXXUPS-GOSISDBHSA-N |
| XLogP | 4.04 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|