C22H27FN2O2 — CID 155062452
(E)-6-[(1R)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methylidenehex-2-enoic acid (PubChem CID 155062452) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is (E)-6-[(1R)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methylidenehex-2-enoic acid.
| Compound Name | (E)-6-[(1R)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methylidenehex-2-enoic acid |
|---|---|
| PubChem CID | 155062452 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (E)-6-[(1R)-2-(2-fluoro-2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-4-methylidenehex-2-enoic acid |
| SMILES | C=C(/C=C/C(=O)O)CC[C@@H]1c2[nH]c3ccccc3c2CCN1CC(C)(C)F |
| InChI | InChI=1S/C22H27FN2O2/c1-15(9-11-20(26)27)8-10-19-21-17(12-13-25(19)14-22(2,3)23)16-6-4-5-7-18(16)24-21/h4-7,9,11,19,24H,1,8,10,12-14H2,2-3H3,(H,26,27)/b11-9+/t19-/m1/s1 |
| InChIKey | QRSFMBSVGAFQTI-SINXNMPMSA-N |
| XLogP | 4.79 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|