C23H29FN2O2 — CID 138643233
(2E)-6-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]hepta-2,6-dienoic acid (PubChem CID 138643233) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is (2E)-6-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]hepta-2,6-dienoic acid.
| Compound Name | (2E)-6-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]hepta-2,6-dienoic acid |
|---|---|
| PubChem CID | 138643233 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (2E)-6-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]hepta-2,6-dienoic acid |
| SMILES | C=C(CC/C=C/C(=O)O)[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1CC(C)(C)F |
| InChI | InChI=1S/C23H29FN2O2/c1-15(9-5-8-12-20(27)28)22-21-18(17-10-6-7-11-19(17)25-21)13-16(2)26(22)14-23(3,4)24/h6-8,10-12,16,22,25H,1,5,9,13-14H2,2-4H3,(H,27,28)/b12-8+/t16-,22-/m1/s1 |
| InChIKey | YSXSRWCZISZJTM-DMTVBNAPSA-N |
| XLogP | 5.18 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|