C24H31FN2 — CID 131979212
(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1-[3-[(E)-prop-1-enyl]-1-bicyclo[1.1.1]pentanyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 131979212) has the molecular formula C24H31FN2 and a molecular weight of 366.52 g/mol. Its IUPAC name is (1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1-[3-[(E)-prop-1-enyl]-1-bicyclo[1.1.1]pentanyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1-[3-[(E)-prop-1-enyl]-1-bicyclo[1.1.1]pentanyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 131979212 |
| Molecular Formula | C24H31FN2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | (1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1-[3-[(E)-prop-1-enyl]-1-bicyclo[1.1.1]pentanyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C/C=C/C12CC([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3CC(C)(C)F)(C1)C2 |
| InChI | InChI=1S/C24H31FN2/c1-5-10-23-12-24(13-23,14-23)21-20-18(17-8-6-7-9-19(17)26-20)11-16(2)27(21)15-22(3,4)25/h5-10,16,21,26H,11-15H2,1-4H3/b10-5+/t16-,21+,23?,24?/m1/s1 |
| InChIKey | BCOBQMBOYZAKNS-JSZKLIESSA-N |
| XLogP | 5.95 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|