C26H28N4O4S — CID 42467413
2,4-dimethoxy-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]benzenesulfonamide (PubChem CID 42467413) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42467413 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2,4-dimethoxy-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2nc(NCCCc3ccccc3)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C26H28N4O4S/c1-33-20-14-15-24(23(17-20)34-2)35(31,32)28-18-25-29-22-13-7-6-12-21(22)26(30-25)27-16-8-11-19-9-4-3-5-10-19/h3-7,9-10,12-15,17,28H,8,11,16,18H2,1-2H3,(H,27,29,30) |
| InChIKey | VTDARFPNAONQKD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|