C27H28N4O2 — CID 26401749
(2S)-2-methoxy-2-phenyl-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]acetamide (PubChem CID 26401749) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is (2S)-2-methoxy-2-phenyl-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]acetamide.
| Compound Name | (2S)-2-methoxy-2-phenyl-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 26401749 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (2S)-2-methoxy-2-phenyl-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]acetamide |
| SMILES | CO[C@H](C(=O)NCc1nc(NCCCc2ccccc2)c2ccccc2n1)c1ccccc1 |
| InChI | InChI=1S/C27H28N4O2/c1-33-25(21-14-6-3-7-15-21)27(32)29-19-24-30-23-17-9-8-16-22(23)26(31-24)28-18-10-13-20-11-4-2-5-12-20/h2-9,11-12,14-17,25H,10,13,18-19H2,1H3,(H,29,32)(H,28,30,31)/t25-/m0/s1 |
| InChIKey | SJTDSUZUYBKJPO-VWLOTQADSA-N |
| XLogP | 4.68 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|