C24H28N6OS — CID 42499579
(4S,6R)-6-methyl-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]-2-sulfanylidene-1,3-diazinane-4-carboxamide (PubChem CID 42499579) has the molecular formula C24H28N6OS and a molecular weight of 448.60 g/mol. Its IUPAC name is (4S,6R)-6-methyl-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]-2-sulfanylidene-1,3-diazinane-4-carboxamide.
| Compound Name | (4S,6R)-6-methyl-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]-2-sulfanylidene-1,3-diazinane-4-carboxamide |
|---|---|
| PubChem CID | 42499579 |
| Molecular Formula | C24H28N6OS |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (4S,6R)-6-methyl-N-[[4-(3-phenylpropylamino)quinazolin-2-yl]methyl]-2-sulfanylidene-1,3-diazinane-4-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C(=O)NCc2nc(NCCCc3ccccc3)c3ccccc3n2)NC(=S)N1 |
| InChI | InChI=1S/C24H28N6OS/c1-16-14-20(29-24(32)27-16)23(31)26-15-21-28-19-12-6-5-11-18(19)22(30-21)25-13-7-10-17-8-3-2-4-9-17/h2-6,8-9,11-12,16,20H,7,10,13-15H2,1H3,(H,26,31)(H,25,28,30)(H2,27,29,32)/t16-,20+/m1/s1 |
| InChIKey | OEKIVUIVODZYDN-UZLBHIALSA-N |
| XLogP | 2.92 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|