C27H46N5O2PS2 — CID 4246800
1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-(3-pyrrolidin-1-ylsulfonylphenyl)thiourea (PubChem CID 4246800) has the molecular formula C27H46N5O2PS2 and a molecular weight of 567.81 g/mol. Its IUPAC name is 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-(3-pyrrolidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-(3-pyrrolidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 4246800 |
| Molecular Formula | C27H46N5O2PS2 |
| Molecular Weight | 567.81 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-(3-pyrrolidin-1-ylsulfonylphenyl)thiourea |
| SMILES | CC(C)(C)P(=NC(=S)Nc1cccc(S(=O)(=O)N2CCCC2)c1)(N1CCCCCC1)N1CCCCCC1 |
| InChI | InChI=1S/C27H46N5O2PS2/c1-27(2,3)35(30-17-8-4-5-9-18-30,31-19-10-6-7-11-20-31)29-26(36)28-24-15-14-16-25(23-24)37(33,34)32-21-12-13-22-32/h14-16,23H,4-13,17-22H2,1-3H3,(H,28,36) |
| InChIKey | WFBRQBIIBQOZBG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.81 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|