C29H43ClN5O2PS2 — CID 5207775
1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]thiourea (PubChem CID 5207775) has the molecular formula C29H43ClN5O2PS2 and a molecular weight of 624.26 g/mol. Its IUPAC name is 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 5207775 |
| Molecular Formula | C29H43ClN5O2PS2 |
| Molecular Weight | 624.26 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 1-[bis(azepan-1-yl)-tert-butyl-λ5-phosphanylidene]-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]thiourea |
| SMILES | CC(C)(C)P(=NC(=S)Nc1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1)(N1CCCCCC1)N1CCCCCC1 |
| InChI | InChI=1S/C29H43ClN5O2PS2/c1-29(2,3)38(34-20-10-4-5-11-21-34,35-22-12-6-7-13-23-35)32-28(39)31-24-16-18-25(19-17-24)40(36,37)33-27-15-9-8-14-26(27)30/h8-9,14-19,33H,4-7,10-13,20-23H2,1-3H3,(H,31,39) |
| InChIKey | XQJGCVNAZLJSEW-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.26 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|