C25H25F2NO3S — CID 42480782
2-[4-[[(2S)-2-(2,4-difluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenoxy]ethanol (PubChem CID 42480782) has the molecular formula C25H25F2NO3S and a molecular weight of 457.54 g/mol. Its IUPAC name is 2-[4-[[(2S)-2-(2,4-difluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[4-[[(2S)-2-(2,4-difluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 42480782 |
| Molecular Formula | C25H25F2NO3S |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-[4-[[(2S)-2-(2,4-difluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenoxy]ethanol |
| SMILES | COc1ccc2c(c1)S[C@H](c1ccc(F)cc1F)CCN2Cc1ccc(OCCO)cc1 |
| InChI | InChI=1S/C25H25F2NO3S/c1-30-20-7-9-23-25(15-20)32-24(21-8-4-18(26)14-22(21)27)10-11-28(23)16-17-2-5-19(6-3-17)31-13-12-29/h2-9,14-15,24,29H,10-13,16H2,1H3/t24-/m0/s1 |
| InChIKey | DNDAZFXHVPXZDY-DEOSSOPVSA-N |
| XLogP | 5.59 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|