C26H26F3NO3S — CID 45227701
5-[(2,3-dimethoxyphenyl)methyl]-8-methoxy-2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-1,5-benzothiazepine (PubChem CID 45227701) has the molecular formula C26H26F3NO3S and a molecular weight of 489.56 g/mol. Its IUPAC name is 5-[(2,3-dimethoxyphenyl)methyl]-8-methoxy-2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-1,5-benzothiazepine.
| Compound Name | 5-[(2,3-dimethoxyphenyl)methyl]-8-methoxy-2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-1,5-benzothiazepine |
|---|---|
| PubChem CID | 45227701 |
| Molecular Formula | C26H26F3NO3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 5-[(2,3-dimethoxyphenyl)methyl]-8-methoxy-2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-1,5-benzothiazepine |
| SMILES | COc1ccc2c(c1)SC(c1cccc(C(F)(F)F)c1)CCN2Cc1cccc(OC)c1OC |
| InChI | InChI=1S/C26H26F3NO3S/c1-31-20-10-11-21-24(15-20)34-23(17-6-4-8-19(14-17)26(27,28)29)12-13-30(21)16-18-7-5-9-22(32-2)25(18)33-3/h4-11,14-15,23H,12-13,16H2,1-3H3 |
| InChIKey | KANMJBUBUWXGDH-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|